Boc-Glu(OtBu)-OH, 97%
cas: 13726-84-6 — see every product listed under this CAS number, including other names
Boc-Glu(OtBu)-OH, 97% (CAS 13726-84-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 50g, 250g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A119108-1g |
| cas | 13726-84-6 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 398.19 Pln | |
| Ambeed | 500g | 1705.38 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 112.40 Pln | |
| Chemat | 50g | 160.40 Pln | |
| Chemat | 100g | 256.40 Pln | |
| Chemat | 250g | 549.20 Pln | |
| Chemat | 500g | 1099.20 Pln | |
| Chemat | 1kg | 2042.00 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 208.84 Pln | |
| BLDpharm | 10g | 236.61 Pln | |
| BLDpharm | 25g | 269.93 Pln | |
| BLDpharm | 100g | 425.43 Pln | |
| BLDpharm | 500g | 1830.49 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CAS 13726-84-6) is a chemical compound with the molecular formula C14H25NO6 and a molecular weight of 303.35 g/mol. IUPAC name: (2S)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid. InChIKey: YGSRAYJBEREVRB-VIFPVBQESA-N.
| Molecular formula | C14H25NO6 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | (2S)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChIKey | YGSRAYJBEREVRB-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
(2S)-5-(tert-butoxy)-2-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid, 5-(1,1-Dimethylethyl) hydrogen N-[(1,1-dimethylethoxy)carbonyl]-L-glutamate, (2S)-5-(tert-butoxy)-2-(((tert-butoxy)carbonyl)amino)-5-oxopentanoic acid, 5-(1,1-Dimethylethyl) hydrogen N-((1,1-dimethylethoxy)carbonyl)-L-glutamate, Boc-Glu(OtBu)-OH, Boc-L-Glu(OtBu)-OH, (S)-5-(tert-Butoxy)-2-((tert-butoxycarbonyl)amino)-5-oxopentanoic acid, N-Boc-L-Glutamic Acid 5-Tert-Butyl Ester, Boc-L-glutamic acid 5-tert-butyl ester, (2S)-5-tert-butoxy-2-(tert-butoxycarbonylamino)-5-oxo-pentanoic acid
