cas: 13726-69-7 — see every product listed under this CAS number, including other names
Boc-L-Hydroxyproline, 97%, 97% (CAS 13726-69-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145K3-1g |
| cas | 13726-69-7 |
| size | 1g |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 69.20 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 88.40 Pln | |
| Chemat | 100g | 102.80 Pln | |
| Chemat | 250g | 160.40 Pln | |
| Chemat | 500g | 331.20 Pln | |
| Chemat | 1kg | 573.20 Pln | |
| Chemat | 5kg | 3048.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S,4R)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 13726-69-7) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: (2S,4R)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: BENKAPCDIOILGV-RQJHMYQMSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (2S,4R)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | BENKAPCDIOILGV-RQJHMYQMSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)O)O |
Computed by PubChem (NCBI)