CAS 946610-68-0 appears in our catalog under these names: rac-(2R,4S)-1-((tert-Butoxy)carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid, trans-1-(tert-Butoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 10mg, 25mg.
(4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 946610-68-0) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: (4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: BENKAPCDIOILGV-PKPIPKONSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | BENKAPCDIOILGV-PKPIPKONSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](CC1C(=O)O)O |
Computed by PubChem (NCBI)