cas: 47375-34-8 — see every product listed under this CAS number, including other names
Boc-L-Tyr(O-tBu)-OH, 98%, 98% (CAS 47375-34-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1181RD-1g |
| cas | 47375-34-8 |
| size | 1g |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 69.20 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 155.60 Pln | |
| Chemat | 100g | 405.20 Pln | |
| Chemat | 250g | 818.00 Pln | |
| Chemat | 500g | 1440.00 Pln | |
| Chemat | 1kg | 2454.80 Pln | |
| Chemat | 50g | 246.80 Pln | |
| Chemat | 5kg | 7108.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid (CAS 47375-34-8) is a chemical compound with the molecular formula C18H27NO5 and a molecular weight of 337.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid. InChIKey: ZEQLLMOXFVKKCN-AWEZNQCLSA-N.
| Molecular formula | C18H27NO5 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid |
| InChIKey | ZEQLLMOXFVKKCN-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)