CAS 18938-60-8 appears in our catalog under these names: Boc-L-Tyr-OtBu, 98%, Boc–Tyr–OtBu, Boc-Tyr-OtBu, 98%, 98%, Boc-Tyr-OtBu, 99.94%, Boc-Tyr-OTbu, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 1kg, 10g, 500 g.
Tert-butyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 18938-60-8) is a chemical compound with the molecular formula C18H27NO5 and a molecular weight of 337.4 g/mol. IUPAC name: tert-butyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: WGJGINMQCMATNP-AWEZNQCLSA-N.
| Molecular formula | C18H27NO5 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | tert-butyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | WGJGINMQCMATNP-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)