Products 1330189-29-1

CAS 1330189-29-1 is the registry number for rac N-tert-Butoxycarbonyl Viloxazine. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-[(2-ethoxyphenoxy)methyl]morpholine-4-carboxylate (CAS 1330189-29-1) is a chemical compound with the molecular formula C18H27NO5 and a molecular weight of 337.4 g/mol. IUPAC name: tert-butyl 2-[(2-ethoxyphenoxy)methyl]morpholine-4-carboxylate. InChIKey: FQZIJLMLSFGBFD-UHFFFAOYSA-N.

Identity
Molecular formulaC18H27NO5
Molecular weight337.4 g/mol
IUPAC nametert-butyl 2-[(2-ethoxyphenoxy)methyl]morpholine-4-carboxylate
InChIKeyFQZIJLMLSFGBFD-UHFFFAOYSA-N
SMILESCCOC1=CC=CC=C1OCC2CN(CCO2)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)