Products 101998-39-4

CAS 101998-39-4 is the registry number for Gadoxetate Disodium Impurity 1. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Ethyl (2S)-3-(4-ethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 101998-39-4) is a chemical compound with the molecular formula C18H27NO5 and a molecular weight of 337.4 g/mol. IUPAC name: ethyl (2S)-3-(4-ethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: ZHPLBVXLZSYGQS-HNNXBMFYSA-N.

Identity
Molecular formulaC18H27NO5
Molecular weight337.4 g/mol
IUPAC nameethyl (2S)-3-(4-ethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate
InChIKeyZHPLBVXLZSYGQS-HNNXBMFYSA-N
SMILESCCOC1=CC=C(C=C1)C[C@@H](C(=O)OCC)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)