cas: 34805-21-5 — see every product listed under this CAS number, including other names
Boc-Met(O)-OH, 96% (CAS 34805-21-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 100g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A117134-1g |
| cas | 34805-21-5 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 414.88 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 280.40 Pln | |
| Chemat | 100g | 808.40 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 25g | 442.09 Pln | |
| Fluorochem | 25g | 398.84 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfinylbutanoic acid (CAS 34805-21-5) is a chemical compound with the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfinylbutanoic acid. InChIKey: FVSDTYGQCVACMH-ISJKBYAMSA-N.
| Molecular formula | C10H19NO5S |
|---|---|
| Molecular weight | 265.33 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfinylbutanoic acid |
| InChIKey | FVSDTYGQCVACMH-ISJKBYAMSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCS(=O)C)C(=O)O |
Computed by PubChem (NCBI)