CAS 81444-65-7 is the registry number for Boc-D-methionine sulfoxide, 95%. Offered by: AmBeed. Available pack sizes: 25g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfinylbutanoic acid (CAS 81444-65-7) is a chemical compound with the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfinylbutanoic acid. InChIKey: FVSDTYGQCVACMH-UFEDUZHUSA-N.
| Molecular formula | C10H19NO5S |
|---|---|
| Molecular weight | 265.33 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfinylbutanoic acid |
| InChIKey | FVSDTYGQCVACMH-UFEDUZHUSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCS(=O)C)C(=O)O |
Computed by PubChem (NCBI)