CAS 34805-21-5 appears in our catalog under these names: Boc–Met(O)–OH, Boc-L-Met(O)-OH, Boc-Met(O)-OH, 96%, 96%, Boc-Met(O)-OH, 95%, Boc-Met(O)-OH, 96%. Offered by: GLPBio, Iris Biotech, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 25g, 1g, 5g, 10g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfinylbutanoic acid (CAS 34805-21-5) is a chemical compound with the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfinylbutanoic acid. InChIKey: FVSDTYGQCVACMH-ISJKBYAMSA-N.
| Molecular formula | C10H19NO5S |
|---|---|
| Molecular weight | 265.33 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfinylbutanoic acid |
| InChIKey | FVSDTYGQCVACMH-ISJKBYAMSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCS(=O)C)C(=O)O |
Computed by PubChem (NCBI)