CAS 1206227-46-4 appears in our catalog under these names: (4S)-2,2-Dioxido-4-isopropyl-1,2,3-oxathiazolidine, n-boc protected, 95%, (S)-tert-Butyl 4-isopropyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98%, (S)-tert-Butyl 4-isopropyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g, 25g.
Tert-butyl (4S)-2,2-dioxo-4-propan-2-yloxathiazolidine-3-carboxylate (CAS 1206227-46-4) is a chemical compound with the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. IUPAC name: tert-butyl (4S)-2,2-dioxo-4-propan-2-yloxathiazolidine-3-carboxylate. InChIKey: FWEXSIHWPAKSOP-MRVPVSSYSA-N.
| Molecular formula | C10H19NO5S |
|---|---|
| Molecular weight | 265.33 g/mol |
| IUPAC name | tert-butyl (4S)-2,2-dioxo-4-propan-2-yloxathiazolidine-3-carboxylate |
| InChIKey | FWEXSIHWPAKSOP-MRVPVSSYSA-N |
| SMILES | CC(C)[C@H]1COS(=O)(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)