cas: 13139-12-3 — see every product listed under this CAS number, including other names
Boc-OSu 98% (CAS 13139-12-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A145479-1g |
| cas | 13139-12-3 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 203.50 Pln | |
| Ambeed | 25g | 281.38 Pln | |
| Ambeed | 100g | 698.56 Pln | |
| Ambeed | 500g | 2895.75 Pln | |
| Ambeed | 1000g | 4597.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A145479 |
Tert-butyl (2,5-dioxopyrrolidin-1-yl) carbonate (CAS 13139-12-3) is a chemical compound with the molecular formula C9H13NO5 and a molecular weight of 215.20 g/mol. IUPAC name: tert-butyl (2,5-dioxopyrrolidin-1-yl) carbonate. InChIKey: VTGFSVGZCYYHLO-UHFFFAOYSA-N.
| Molecular formula | C9H13NO5 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | tert-butyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| InChIKey | VTGFSVGZCYYHLO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)