Products 112913-62-9

CAS 112913-62-9 is the registry number for IB-OSu. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2,5-dioxopyrrolidin-1-yl) 2-methylpropyl carbonate (CAS 112913-62-9) is a chemical compound with the molecular formula C9H13NO5 and a molecular weight of 215.20 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-methylpropyl carbonate. InChIKey: LNLUEQNONJYKRK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13NO5
Molecular weight215.20 g/mol
IUPAC name(2,5-dioxopyrrolidin-1-yl) 2-methylpropyl carbonate
InChIKeyLNLUEQNONJYKRK-UHFFFAOYSA-N
SMILESCC(C)COC(=O)ON1C(=O)CCC1=O

Computed by PubChem (NCBI)