CAS 56074-21-6 appears in our catalog under these names: tert-Butyl 2,6-dioxomorpholine-4-carboxylate 97%, tert-Butyl 2,6-dioxomorpholine-4-carboxylate, 97%, 97%, tert-Butyl 2,6-dioxomorpholine-4-carboxylate, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
Tert-butyl 2,6-dioxomorpholine-4-carboxylate (CAS 56074-21-6) is a chemical compound with the molecular formula C9H13NO5 and a molecular weight of 215.20 g/mol. IUPAC name: tert-butyl 2,6-dioxomorpholine-4-carboxylate. InChIKey: XNOCWDLRABXTAT-UHFFFAOYSA-N.
| Molecular formula | C9H13NO5 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | tert-butyl 2,6-dioxomorpholine-4-carboxylate |
| InChIKey | XNOCWDLRABXTAT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)OC(=O)C1 |
Computed by PubChem (NCBI)