CAS 7491-35-2 is the registry number for Gentisic Acid Ethanolamine. Offered by: Chemat Brand. Available pack sizes: on request.
2-aminoethanol;2,5-dihydroxybenzoic acid (CAS 7491-35-2) is a chemical compound with the molecular formula C9H13NO5 and a molecular weight of 215.20 g/mol. IUPAC name: 2-aminoethanol;2,5-dihydroxybenzoic acid. InChIKey: AKTFIQYVASYRMU-UHFFFAOYSA-N.
| Molecular formula | C9H13NO5 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 2-aminoethanol;2,5-dihydroxybenzoic acid |
| InChIKey | AKTFIQYVASYRMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)C(=O)O)O.C(CO)N |
Computed by PubChem (NCBI)