Products 7491-35-2

CAS 7491-35-2 is the registry number for Gentisic Acid Ethanolamine. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-aminoethanol;2,5-dihydroxybenzoic acid (CAS 7491-35-2) is a chemical compound with the molecular formula C9H13NO5 and a molecular weight of 215.20 g/mol. IUPAC name: 2-aminoethanol;2,5-dihydroxybenzoic acid. InChIKey: AKTFIQYVASYRMU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13NO5
Molecular weight215.20 g/mol
IUPAC name2-aminoethanol;2,5-dihydroxybenzoic acid
InChIKeyAKTFIQYVASYRMU-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1O)C(=O)O)O.C(CO)N

Computed by PubChem (NCBI)