cas: 113400-36-5 — see every product listed under this CAS number, including other names
Boc-Pyr-Obzl 97% (CAS 113400-36-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A134826-5g |
| cas | 113400-36-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 164.56 Pln | |
| Ambeed | 500g | 492.75 Pln | |
| Ambeed | 1000g | 798.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A134826 |
2-O-benzyl 1-O-tert-butyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate (CAS 113400-36-5) is a chemical compound with the molecular formula C17H21NO5 and a molecular weight of 319.4 g/mol. IUPAC name: 2-O-benzyl 1-O-tert-butyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: TZNBTMCEMLXYEM-ZDUSSCGKSA-N.
| Molecular formula | C17H21NO5 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 2-O-benzyl 1-O-tert-butyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | TZNBTMCEMLXYEM-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CCC1=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)