CAS 400626-71-3 appears in our catalog under these names: (R)-2-Benzyl 1-tert-butyl 5-oxopyrrolidi, ne-1,2-dicarboxylate, 250 mg, (R)–2–Benzyl 1–tert–butyl 5–oxopyrrolidine–1，2–dicarboxylate, (R)-2-Benzyl 1-tert-butyl 5-oxopyrrolidine-1,2-dicarboxylate, Boc-D-Pyr-OBzl 95%, (R)-2-Benzyl 1-tert-butyl 5-oxopyrrolidine-1,2-dicarboxylate, 95%, 95%. Offered by: Roth, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 0,25g, 0,5g, 2g, 5g, 100mg, 10g.
2-O-benzyl 1-O-tert-butyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate (CAS 400626-71-3) is a chemical compound with the molecular formula C17H21NO5 and a molecular weight of 319.4 g/mol. IUPAC name: 2-O-benzyl 1-O-tert-butyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: TZNBTMCEMLXYEM-CYBMUJFWSA-N.
| Molecular formula | C17H21NO5 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 2-O-benzyl 1-O-tert-butyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | TZNBTMCEMLXYEM-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CCC1=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)