cas: 13734-41-3 — see every product listed under this CAS number, including other names
Boc-Val-OH, 98% (CAS 13734-41-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg, 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1146AR-5g |
| cas | 13734-41-3 |
| size | 5g |
| availability | 20000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 98.00 Pln | |
| Chemat | 500g | 297.60 Pln | |
| Chemat | 1kg | 515.60 Pln | |
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 10g | 154.13 Pln | |
| Fluorochem | 25g | 169.75 Pln | |
| Fluorochem | 100g | 180.16 Pln | |
| Fluorochem | 500g | 299.91 Pln | |
| Fluorochem | 1kg | 747.67 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 13734-41-3) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: SZXBQTSZISFIAO-ZETCQYMHSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | SZXBQTSZISFIAO-ZETCQYMHSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)