CAS 141509-91-3 appears in our catalog under these names: Boc-(15N)Val-OH, Boc-L-Valine-15N. Offered by: Creative Peptides, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, Get quote.
(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl(15N)amino]butanoic acid (CAS 141509-91-3) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 218.26 g/mol. IUPAC name: (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl(15N)amino]butanoic acid. InChIKey: SZXBQTSZISFIAO-PFGINBISSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 218.26 g/mol |
| IUPAC name | (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl(15N)amino]butanoic acid |
| InChIKey | SZXBQTSZISFIAO-PFGINBISSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)[15NH]C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)