CAS 54895-12-4 appears in our catalog under these names: Boc-DL-Val-OH, 98%, BOC-DL-VAL-OH, Boc–DL–Val–OH, BOC-DL-Valine, 98%, Boc-DL-Val-OH 97%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Thermo Scientific (Acros), Ambeed. Available pack sizes: 100g, 25g, 500g, 5g, on request, 10g, 50g, 1000g.
3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 54895-12-4) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: SZXBQTSZISFIAO-UHFFFAOYSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | SZXBQTSZISFIAO-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)