Products 153568-33-3
CAS 153568-33-3 appears in our catalog under these names: L-Valine-d8-N-t-BOC, 98 atom % D, min 98% Chemical Purity, Boc–L–Valine–d8, Boc-L-Valine-d8, 99.62%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 10mg, 25mg, 25 mg, 10 mg, 5 mg.
(2S)-2,3,4,4,4-pentadeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trideuteriomethyl)butanoic acid (CAS 153568-33-3) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 225.31 g/mol. IUPAC name: (2S)-2,3,4,4,4-pentadeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trideuteriomethyl)butanoic acid. InChIKey: SZXBQTSZISFIAO-SSOOLOFBSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 225.31 g/mol |
| IUPAC name | (2S)-2,3,4,4,4-pentadeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trideuteriomethyl)butanoic acid |
| InChIKey | SZXBQTSZISFIAO-SSOOLOFBSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)