cas: 41117-66-2 — see every product listed under this CAS number, including other names
Boc-cys(3,4-dimethylbenzyl)-oh, 95% (CAS 41117-66-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | QB-5921-1g |
| cas | 41117-66-2 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 1122.54 Pln | |
| Fluorochem | 10g | 2169.05 Pln | |
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 993.38 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 861.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
(2R)-3-[(3,4-dimethylphenyl)methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 41117-66-2) is a chemical compound with the molecular formula C17H25NO4S and a molecular weight of 339.5 g/mol. IUPAC name: (2R)-3-[(3,4-dimethylphenyl)methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: AYUOVKILVZAKFO-AWEZNQCLSA-N.
| Molecular formula | C17H25NO4S |
|---|---|
| Molecular weight | 339.5 g/mol |
| IUPAC name | (2R)-3-[(3,4-dimethylphenyl)methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | AYUOVKILVZAKFO-AWEZNQCLSA-N |
| SMILES | CC1=C(C=C(C=C1)CSC[C@@H](C(=O)O)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)