CAS 885269-54-5 appears in our catalog under these names: 1-(2,3,5,6-Tetramethylphenylsulfonylamino)cyclohexanecarboxylic acid, 95%, 1–((2,3,5,6–Tetramethylphenyl)sulfonamido)cyclohexane–1–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1-[(2,3,5,6-tetramethylphenyl)sulfonylamino]cyclohexane-1-carboxylic acid (CAS 885269-54-5) is a chemical compound with the molecular formula C17H25NO4S and a molecular weight of 339.5 g/mol. IUPAC name: 1-[(2,3,5,6-tetramethylphenyl)sulfonylamino]cyclohexane-1-carboxylic acid. InChIKey: AUJXKRTUDQFEGI-UHFFFAOYSA-N.
| Molecular formula | C17H25NO4S |
|---|---|
| Molecular weight | 339.5 g/mol |
| IUPAC name | 1-[(2,3,5,6-tetramethylphenyl)sulfonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | AUJXKRTUDQFEGI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)NC2(CCCCC2)C(=O)O)C)C |
Computed by PubChem (NCBI)