CAS 885269-57-8 is the registry number for 1–((4–(tert–Butyl)phenyl)sulfonamido)cyclohexane–1–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
1-[(4-tert-butylphenyl)sulfonylamino]cyclohexane-1-carboxylic acid (CAS 885269-57-8) is a chemical compound with the molecular formula C17H25NO4S and a molecular weight of 339.5 g/mol. IUPAC name: 1-[(4-tert-butylphenyl)sulfonylamino]cyclohexane-1-carboxylic acid. InChIKey: NFQLNZWUUMJXOS-UHFFFAOYSA-N.
| Molecular formula | C17H25NO4S |
|---|---|
| Molecular weight | 339.5 g/mol |
| IUPAC name | 1-[(4-tert-butylphenyl)sulfonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | NFQLNZWUUMJXOS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)NC2(CCCCC2)C(=O)O |
Computed by PubChem (NCBI)