Products 885269-57-8

CAS 885269-57-8 is the registry number for 1–((4–(tert–Butyl)phenyl)sulfonamido)cyclohexane–1–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-[(4-tert-butylphenyl)sulfonylamino]cyclohexane-1-carboxylic acid (CAS 885269-57-8) is a chemical compound with the molecular formula C17H25NO4S and a molecular weight of 339.5 g/mol. IUPAC name: 1-[(4-tert-butylphenyl)sulfonylamino]cyclohexane-1-carboxylic acid. InChIKey: NFQLNZWUUMJXOS-UHFFFAOYSA-N.

Identity
Molecular formulaC17H25NO4S
Molecular weight339.5 g/mol
IUPAC name1-[(4-tert-butylphenyl)sulfonylamino]cyclohexane-1-carboxylic acid
InChIKeyNFQLNZWUUMJXOS-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC=C(C=C1)S(=O)(=O)NC2(CCCCC2)C(=O)O

Computed by PubChem (NCBI)