CAS 201419-15-0 appears in our catalog under these names: Boc-homocys(mbzl)-oh, 98%, Boc–Homocys(Mbzl)–OH. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 25g.
(2S)-4-[(4-methylphenyl)methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 201419-15-0) is a chemical compound with the molecular formula C17H25NO4S and a molecular weight of 339.5 g/mol. IUPAC name: (2S)-4-[(4-methylphenyl)methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LIUGCVMBJYHYNA-AWEZNQCLSA-N.
| Molecular formula | C17H25NO4S |
|---|---|
| Molecular weight | 339.5 g/mol |
| IUPAC name | (2S)-4-[(4-methylphenyl)methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | LIUGCVMBJYHYNA-AWEZNQCLSA-N |
| SMILES | CC1=CC=C(C=C1)CSCC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)