cas: 198211-79-9 — see every product listed under this CAS number, including other names
Boronic acid, B-(2-methoxy-4-methylphenyl)-, 95%+, 95%+ (CAS 198211-79-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113BDP-100mg |
| cas | 198211-79-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 549.20 Pln | |
| Chemat | 250mg | 885.20 Pln | |
| Chemat | 1g | 2286.80 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
(2-methoxy-4-methylphenyl)boronic acid (CAS 198211-79-9) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: (2-methoxy-4-methylphenyl)boronic acid. InChIKey: LWNWZQJRSFHZRG-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | (2-methoxy-4-methylphenyl)boronic acid |
| InChIKey | LWNWZQJRSFHZRG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C)OC)(O)O |
Computed by PubChem (NCBI)