cas: 1704067-18-4 — see every product listed under this CAS number, including other names
Boronic acid, B-[3,4-difluoro-5-(4-morpholinyl)phenyl]-, 95%, 95% (CAS 1704067-18-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AR0T-250mg |
| cas | 1704067-18-4 |
| size | 250mg |
| availability | 3.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 2541.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3,4-difluoro-5-morpholin-4-ylphenyl)boronic acid (CAS 1704067-18-4) is a chemical compound with the molecular formula C10H12BF2NO3 and a molecular weight of 243.02 g/mol. IUPAC name: (3,4-difluoro-5-morpholin-4-ylphenyl)boronic acid. InChIKey: UGEHYGVQNISVFA-UHFFFAOYSA-N.
| Molecular formula | C10H12BF2NO3 |
|---|---|
| Molecular weight | 243.02 g/mol |
| IUPAC name | (3,4-difluoro-5-morpholin-4-ylphenyl)boronic acid |
| InChIKey | UGEHYGVQNISVFA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)F)N2CCOCC2)(O)O |
Computed by PubChem (NCBI)