cas: 3044-56-2 — see every product listed under this CAS number, including other names
Butyric 3,4,5-trimethoxybenzoic anhydride, 95%, 95% (CAS 3044-56-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11415Y-250mg |
| cas | 3044-56-2 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 731.60 Pln | |
| Chemat | 10g | 1264.40 Pln | |
| Chemat | 25g | 2402.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-oxo-3-(3,4,5-trimethoxyphenyl)propanoate (CAS 3044-56-2) is a chemical compound with the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. IUPAC name: ethyl 3-oxo-3-(3,4,5-trimethoxyphenyl)propanoate. InChIKey: VEYNISLTHXQSGU-UHFFFAOYSA-N.
| Molecular formula | C14H18O6 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | ethyl 3-oxo-3-(3,4,5-trimethoxyphenyl)propanoate |
| InChIKey | VEYNISLTHXQSGU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC(=C(C(=C1)OC)OC)OC |
Computed by PubChem (NCBI)