Products 2270907-86-1
CAS 2270907-86-1 is the registry number for 5-tert-Butoxycarbonylmethoxy-2-hydroxy-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-hydroxy-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]benzoate (CAS 2270907-86-1) is a chemical compound with the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. IUPAC name: methyl 2-hydroxy-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]benzoate. InChIKey: BQCZGVRGXSRVCO-UHFFFAOYSA-N.
| Molecular formula | C14H18O6 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | methyl 2-hydroxy-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]benzoate |
| InChIKey | BQCZGVRGXSRVCO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COC1=CC(=C(C=C1)O)C(=O)OC |
Computed by PubChem (NCBI)