cas: 3044-56-2 — see every product listed under this CAS number, including other names
Ethyl 3,4,5-trimethoxybenzoylacetate (CAS 3044-56-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F390432-100MG |
| cas | 3044-56-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 440.49 Pln | |
| Fluorochem | 5g | 1330.80 Pln | |
| Fluorochem | 10g | 2049.30 Pln | |
| Fluorochem | 25g | 4918.08 Pln |
| delivery time | 2-3 weeks |
|---|
Ethyl 3-oxo-3-(3,4,5-trimethoxyphenyl)propanoate (CAS 3044-56-2) is a chemical compound with the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. IUPAC name: ethyl 3-oxo-3-(3,4,5-trimethoxyphenyl)propanoate. InChIKey: VEYNISLTHXQSGU-UHFFFAOYSA-N.
| Molecular formula | C14H18O6 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | ethyl 3-oxo-3-(3,4,5-trimethoxyphenyl)propanoate |
| InChIKey | VEYNISLTHXQSGU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC(=C(C(=C1)OC)OC)OC |
Computed by PubChem (NCBI)