CAS 3044-56-2 appears in our catalog under these names: Ethyl 3,4,5-trimethoxybenzoylacetate, 96%, Ethyl 3,4,5–trimethoxybenzoylacetate, Butyric 3,4,5-trimethoxybenzoic anhydride 95%, ETHYL 3,4,5-TRIMETHOXYBENZOYLACETATE,, Butyric 3,4,5-trimethoxybenzoic anhydride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 25g, 100mg.
Ethyl 3-oxo-3-(3,4,5-trimethoxyphenyl)propanoate (CAS 3044-56-2) is a chemical compound with the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. IUPAC name: ethyl 3-oxo-3-(3,4,5-trimethoxyphenyl)propanoate. InChIKey: VEYNISLTHXQSGU-UHFFFAOYSA-N.
| Molecular formula | C14H18O6 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | ethyl 3-oxo-3-(3,4,5-trimethoxyphenyl)propanoate |
| InChIKey | VEYNISLTHXQSGU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC(=C(C(=C1)OC)OC)OC |
Computed by PubChem (NCBI)