Bz-Met-OH 98%
cas: 10290-61-6 — see every product listed under this CAS number, including other names
Bz-Met-OH 98% (CAS 10290-61-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A380303-1g |
| cas | 10290-61-6 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 437.12 Pln | |
| Ambeed | 25g | 1538.50 Pln | |
| Ambeed | 100g | 4497.75 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A380303 |
(2S)-2-benzamido-4-methylsulfanylbutanoic acid (CAS 10290-61-6) is a chemical compound with the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. IUPAC name: (2S)-2-benzamido-4-methylsulfanylbutanoic acid. InChIKey: PPFRJEXUPZWQPI-JTQLQIEISA-N.
| Molecular formula | C12H15NO3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | (2S)-2-benzamido-4-methylsulfanylbutanoic acid |
| InChIKey | PPFRJEXUPZWQPI-JTQLQIEISA-N |
| SMILES | CSCC[C@@H](C(=O)O)NC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)