CAS 157736-55-5 appears in our catalog under these names: 2-Cyano-2-methylpropyl 4-methylbenzenesulfonate, 95%, 2-Cyano-2-methylpropyl 4-methylbenzenesulfonate, 97%, 2-Cyano-2-methylpropyl 4-methylbenzenesulfonate, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
(2-cyano-2-methylpropyl) 4-methylbenzenesulfonate (CAS 157736-55-5) is a chemical compound with the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. IUPAC name: (2-cyano-2-methylpropyl) 4-methylbenzenesulfonate. InChIKey: IBJJIYVWUTVKGM-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | (2-cyano-2-methylpropyl) 4-methylbenzenesulfonate |
| InChIKey | IBJJIYVWUTVKGM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(C)(C)C#N |
Computed by PubChem (NCBI)