CAS 63826-34-6 is the registry number for 2-(Acetylamino)-5,6,7,8-tetrahydro-4h-cyclohepta[b]thiophene-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-acetamido-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylic acid (CAS 63826-34-6) is a chemical compound with the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. IUPAC name: 2-acetamido-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylic acid. InChIKey: DEDWHJVDTMELPW-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | 2-acetamido-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylic acid |
| InChIKey | DEDWHJVDTMELPW-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C2=C(S1)CCCCC2)C(=O)O |
Computed by PubChem (NCBI)