Products 1330061-67-0
CAS 1330061-67-0 appears in our catalog under these names: CAIX Inhibitor S4/ 98.35% (existing batch purity), S4, CAIX Inhibitor S4, 99.04%, 4-(3-(3,5-Dimethylphenyl)ureido)phenyl sulfamate, 98%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 25 mg.
[4-[(3,5-dimethylphenyl)carbamoylamino]phenyl] sulfamate (CAS 1330061-67-0) is a chemical compound with the molecular formula C15H17N3O4S and a molecular weight of 335.4 g/mol. IUPAC name: [4-[(3,5-dimethylphenyl)carbamoylamino]phenyl] sulfamate. InChIKey: HGVHSNXRZYOTPD-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O4S |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | [4-[(3,5-dimethylphenyl)carbamoylamino]phenyl] sulfamate |
| InChIKey | HGVHSNXRZYOTPD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NC(=O)NC2=CC=C(C=C2)OS(=O)(=O)N)C |
Computed by PubChem (NCBI)