CAS 1210360-87-4 appears in our catalog under these names: CAY10781/ 98.69% (existing batch purity), CAY10781, CAY10781, 98.04%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
2-(6-oxo-2-pyridin-3-yl-1H-pyrimidin-5-yl)acetic acid (CAS 1210360-87-4) is a chemical compound with the molecular formula C11H9N3O3 and a molecular weight of 231.21 g/mol. IUPAC name: 2-(6-oxo-2-pyridin-3-yl-1H-pyrimidin-5-yl)acetic acid. InChIKey: PQXHMOPMDOFJHD-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O3 |
|---|---|
| Molecular weight | 231.21 g/mol |
| IUPAC name | 2-(6-oxo-2-pyridin-3-yl-1H-pyrimidin-5-yl)acetic acid |
| InChIKey | PQXHMOPMDOFJHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC=C(C(=O)N2)CC(=O)O |
Computed by PubChem (NCBI)