CBz-n-amido-peg3-acid, 98%, 98%
cas: 1310327-18-4 — see every product listed under this CAS number, including other names
CBz-n-amido-peg3-acid, 98%, 98% (CAS 1310327-18-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111VD0-100mg |
| cas | 1310327-18-4 |
| size | 100mg |
| availability | 100g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 395.60 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1782.80 Pln | |
| Chemat | 25g | 3506.00 Pln | |
| Chemat | 50g | 6266.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1310327-18-4) is a chemical compound with the molecular formula C17H25NO7 and a molecular weight of 355.4 g/mol. IUPAC name: 3-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: SBHUTZVKPJPFBD-UHFFFAOYSA-N.
| Molecular formula | C17H25NO7 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 3-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | SBHUTZVKPJPFBD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Cbz-N-amido-PEG3-acid, Cbz-NH-PEG3-C2-acid, CbzNH-PEG3-CH2CH2COOH, 3-oxo-1-phenyl-2,7,10,13-tetraoxa-4-azahexadecan-16-oic acid, 5,8,11-Trioxa-2-azatetradecanedioic acid, 1-(phenylmethyl) ester, 3-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid, CBZ-NH-PEG3-acid, Cbz-N-amido-PEG3-COOH, orb1909437, 3-[2-[2-[2-(benzyloxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid