CBz-n-amido-peg3-acid 95%
cas: 1310327-18-4 — see every product listed under this CAS number, including other names
CBz-n-amido-peg3-acid 95% (CAS 1310327-18-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A755988-100mg |
| cas | 1310327-18-4 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1850.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A755988 |
3-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1310327-18-4) is a chemical compound with the molecular formula C17H25NO7 and a molecular weight of 355.4 g/mol. IUPAC name: 3-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: SBHUTZVKPJPFBD-UHFFFAOYSA-N.
| Molecular formula | C17H25NO7 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 3-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | SBHUTZVKPJPFBD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Cbz-N-amido-PEG3-acid, Cbz-NH-PEG3-C2-acid, CbzNH-PEG3-CH2CH2COOH, 3-oxo-1-phenyl-2,7,10,13-tetraoxa-4-azahexadecan-16-oic acid, 5,8,11-Trioxa-2-azatetradecanedioic acid, 1-(phenylmethyl) ester, 3-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid, CBZ-NH-PEG3-acid, Cbz-N-amido-PEG3-COOH, orb1909437, 3-[2-[2-[2-(benzyloxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid