CAS 1310327-18-4 appears in our catalog under these names: Cbz-n-amido-peg3-acid, 95%, Cbz–NH–PEG3–C2–acid, CBz-n-amido-peg3-acid 95%, Cbz-NH-PEG3-C2-acid, 99.82%, CBz-n-amido-peg3-acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, MedChemExpress, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 100 mg, 1 g, 250 mg, 5 g.
3-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1310327-18-4) is a chemical compound with the molecular formula C17H25NO7 and a molecular weight of 355.4 g/mol. IUPAC name: 3-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: SBHUTZVKPJPFBD-UHFFFAOYSA-N.
| Molecular formula | C17H25NO7 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 3-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | SBHUTZVKPJPFBD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)