cas: 1310327-18-4 — see every product listed under this CAS number, including other names
Cbz-NH-PEG3-C2-acid, 98% (CAS 1310327-18-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F987097-100MG |
| cas | 1310327-18-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 924.69 Pln | |
| Fluorochem | 5g | 3101.01 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1310327-18-4) is a chemical compound with the molecular formula C17H25NO7 and a molecular weight of 355.4 g/mol. IUPAC name: 3-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: SBHUTZVKPJPFBD-UHFFFAOYSA-N.
| Molecular formula | C17H25NO7 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 3-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | SBHUTZVKPJPFBD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)