CAS 1616271-41-0 appears in our catalog under these names: CCTA-1523/ 99.03% (existing batch purity), CCTA-1523. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg.
2,2-dichloro-N-[3-(3,4-dimethoxyphenyl)phenyl]acetamide (CAS 1616271-41-0) is a chemical compound with the molecular formula C16H15Cl2NO3 and a molecular weight of 340.2 g/mol. IUPAC name: 2,2-dichloro-N-[3-(3,4-dimethoxyphenyl)phenyl]acetamide. InChIKey: KVFQJGFFQSVTND-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl2NO3 |
|---|---|
| Molecular weight | 340.2 g/mol |
| IUPAC name | 2,2-dichloro-N-[3-(3,4-dimethoxyphenyl)phenyl]acetamide |
| InChIKey | KVFQJGFFQSVTND-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=CC=C2)NC(=O)C(Cl)Cl)OC |
Computed by PubChem (NCBI)