CAS 95853-92-2 appears in our catalog under these names: CGS 15435/ 99.63% (existing batch purity), CGS 15435, CGS 15435. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg.
6-(5-chloro-1-methyl-2-pyridin-3-ylindol-3-yl)hexanoic acid (CAS 95853-92-2) is a chemical compound with the molecular formula C20H21ClN2O2 and a molecular weight of 356.8 g/mol. IUPAC name: 6-(5-chloro-1-methyl-2-pyridin-3-ylindol-3-yl)hexanoic acid. InChIKey: BYQANTGKEVLUKZ-UHFFFAOYSA-N.
| Molecular formula | C20H21ClN2O2 |
|---|---|
| Molecular weight | 356.8 g/mol |
| IUPAC name | 6-(5-chloro-1-methyl-2-pyridin-3-ylindol-3-yl)hexanoic acid |
| InChIKey | BYQANTGKEVLUKZ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Cl)C(=C1C3=CN=CC=C3)CCCCCC(=O)O |
Computed by PubChem (NCBI)