Products 678158-55-9
CAS 678158-55-9 appears in our catalog under these names: CLZ-8/ 99.85% (existing batch purity), Mcl1–IN–8, Mcl1-IN-8, CLZ-8 98%, CLZ-8. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 50 mg.
(5Z)-2-[4-(2-hydroxyethyl)piperazin-1-yl]-5-[(4-phenylphenyl)methylidene]-1,3-thiazol-4-one (CAS 678158-55-9) is a chemical compound with the molecular formula C22H23N3O2S and a molecular weight of 393.5 g/mol. IUPAC name: (5Z)-2-[4-(2-hydroxyethyl)piperazin-1-yl]-5-[(4-phenylphenyl)methylidene]-1,3-thiazol-4-one. InChIKey: IBEWMFVUBLAYJT-SILNSSARSA-N.
| Molecular formula | C22H23N3O2S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | (5Z)-2-[4-(2-hydroxyethyl)piperazin-1-yl]-5-[(4-phenylphenyl)methylidene]-1,3-thiazol-4-one |
| InChIKey | IBEWMFVUBLAYJT-SILNSSARSA-N |
| SMILES | C1CN(CCN1CCO)C2=NC(=O)/C(=C/C3=CC=C(C=C3)C4=CC=CC=C4)/S2 |
Computed by PubChem (NCBI)