cas: 51828-95-6 — see every product listed under this CAS number, including other names
Calcium 4-Methyl-2-oxovalerate, >98.0%(T) (CAS 51828-95-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | K0023-5G |
| cas | 51828-95-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 482.22 Pln | |
| TCI | 25g | 1500.09 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
Calcium bis(4-methyl-2-oxopentanoate) (CAS 51828-95-6) is a chemical compound with the molecular formula C12H18CaO6 and a molecular weight of 298.35 g/mol. IUPAC name: calcium bis(4-methyl-2-oxopentanoate). InChIKey: WQZNGJIBHXYVNW-UHFFFAOYSA-L.
| Molecular formula | C12H18CaO6 |
|---|---|
| Molecular weight | 298.35 g/mol |
| IUPAC name | calcium bis(4-methyl-2-oxopentanoate) |
| InChIKey | WQZNGJIBHXYVNW-UHFFFAOYSA-L |
| SMILES | CC(C)CC(=O)C(=O)[O-].CC(C)CC(=O)C(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)