CAS 66872-75-1 appears in our catalog under these names: 3-Methyl-2-oxovaleric acid calcium salt, 95%, Calcium 3-methyl-2-oxovalerate hydrate, 97%, Calcium 3-Methyl-2-Oxovalerate, 3-Methyl-2-oxovaleric acid calcium salt, Calcium 3-methyl-2-oxopentanoate. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: 10g, 5g, 25g, 1g, on request, 100mg, 500mg, 50mg.
Calcium bis(3-methyl-2-oxopentanoate) (CAS 66872-75-1) is a chemical compound with the molecular formula C12H18CaO6 and a molecular weight of 298.35 g/mol. IUPAC name: calcium bis(3-methyl-2-oxopentanoate). InChIKey: PTFSVYLXDCGPFY-UHFFFAOYSA-L.
| Molecular formula | C12H18CaO6 |
|---|---|
| Molecular weight | 298.35 g/mol |
| IUPAC name | calcium bis(3-methyl-2-oxopentanoate) |
| InChIKey | PTFSVYLXDCGPFY-UHFFFAOYSA-L |
| SMILES | CCC(C)C(=O)C(=O)[O-].CCC(C)C(=O)C(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)