CAS 51828-95-6 appears in our catalog under these names: Calcium 4-methyl-2-oxovalerate dihydrate, 95%, Calcium 4-methyl-2-oxovalerate hydrate, 97%, 2-Ketoleucine calcium salt, 97%, Calcium 4-Methyl-2-Oxovalerate, 4–Methyl–2–oxopentanoic acid (hemicalcium). Offered by: Combi-blocks, Chemat Brand, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 5g, 100g, 1g, on request, 0,1kg, 0,25kg, 0,5kg.
Calcium bis(4-methyl-2-oxopentanoate) (CAS 51828-95-6) is a chemical compound with the molecular formula C12H18CaO6 and a molecular weight of 298.35 g/mol. IUPAC name: calcium bis(4-methyl-2-oxopentanoate). InChIKey: WQZNGJIBHXYVNW-UHFFFAOYSA-L.
| Molecular formula | C12H18CaO6 |
|---|---|
| Molecular weight | 298.35 g/mol |
| IUPAC name | calcium bis(4-methyl-2-oxopentanoate) |
| InChIKey | WQZNGJIBHXYVNW-UHFFFAOYSA-L |
| SMILES | CC(C)CC(=O)C(=O)[O-].CC(C)CC(=O)C(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)