CAS 51828-96-7 is the registry number for Calcium (S)-3-Methyl-2-Oxovalerate. Offered by: Chemat Brand. Available pack sizes: on request.
Calcium bis((3S)-3-methyl-2-oxopentanoate) (CAS 51828-96-7) is a chemical compound with the molecular formula C12H18CaO6 and a molecular weight of 298.35 g/mol. IUPAC name: calcium bis((3S)-3-methyl-2-oxopentanoate). InChIKey: PTFSVYLXDCGPFY-SCGRZTRASA-L.
| Molecular formula | C12H18CaO6 |
|---|---|
| Molecular weight | 298.35 g/mol |
| IUPAC name | calcium bis((3S)-3-methyl-2-oxopentanoate) |
| InChIKey | PTFSVYLXDCGPFY-SCGRZTRASA-L |
| SMILES | CC[C@H](C)C(=O)C(=O)[O-].CC[C@H](C)C(=O)C(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)