Products 1002096-67-4

CAS 1002096-67-4 is the registry number for Caldaret HCl/ 99.06% (existing batch purity). Offered by: TargetMol. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.

Structural formula: {0} (CAS {1})

5-methyl-2-piperazin-1-ylbenzenesulfonic acid;hydrochloride (CAS 1002096-67-4) is a chemical compound with the molecular formula C11H17ClN2O3S and a molecular weight of 292.78 g/mol. IUPAC name: 5-methyl-2-piperazin-1-ylbenzenesulfonic acid;hydrochloride. InChIKey: KOHCMEQQIUUGTH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17ClN2O3S
Molecular weight292.78 g/mol
IUPAC name5-methyl-2-piperazin-1-ylbenzenesulfonic acid;hydrochloride
InChIKeyKOHCMEQQIUUGTH-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)N2CCNCC2)S(=O)(=O)O.Cl

Computed by PubChem (NCBI)