CAS 55824-13-0 appears in our catalog under these names: Cannabidiphorol, Cannabidiphorol (CBDP) 100 µg/mL in Acetonitrile, Cannabidiphorol (CBDP) 1000 µg/mL in Acetonitrile, CBDP, 5-Heptyl-2-((1R,6R)-3-methyl-6-(1-methylethenyl)-2-cyclohexen-1-yl)-1,3-benzenediol. Offered by: Dr. Ehrenstorfer, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 1ml, 1mg, 5mg, 25mg, 50mg, 100mg, 250mg.
5-heptyl-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3-diol (CAS 55824-13-0) is a chemical compound with the molecular formula C23H34O2 and a molecular weight of 342.5 g/mol. IUPAC name: 5-heptyl-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3-diol. InChIKey: GGHRHCGOMWNLCE-VQTJNVASSA-N.
| Molecular formula | C23H34O2 |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | 5-heptyl-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3-diol |
| InChIKey | GGHRHCGOMWNLCE-VQTJNVASSA-N |
| SMILES | CCCCCCCC1=CC(=C(C(=C1)O)[C@@H]2C=C(CC[C@H]2C(=C)C)C)O |
Computed by PubChem (NCBI)