cas: 175393-09-6 — see every product listed under this CAS number, including other names
Carbamic acid, (5-bromo-2-pyridinyl)-, phenylmethyl ester, 98%, 98% (CAS 175393-09-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1131YG-100mg |
| cas | 175393-09-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 5g | 2147.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl N-(5-bromo-2-pyridinyl)carbamate (CAS 175393-09-6) is a chemical compound with the molecular formula C13H11BrN2O2 and a molecular weight of 307.14 g/mol. IUPAC name: benzyl N-(5-bromo-2-pyridinyl)carbamate. InChIKey: XAHHPDSPSWOXMS-UHFFFAOYSA-N.
| Molecular formula | C13H11BrN2O2 |
|---|---|
| Molecular weight | 307.14 g/mol |
| IUPAC name | benzyl N-(5-bromo-2-pyridinyl)carbamate |
| InChIKey | XAHHPDSPSWOXMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)